C23H21N3O5 — CID 123940802
ethyl 6-(4-methyl-3-nitrobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate (PubChem CID 123940802) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is ethyl 6-(4-methyl-3-nitrobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate.
| Compound Name | ethyl 6-(4-methyl-3-nitrobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
|---|---|
| PubChem CID | 123940802 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | ethyl 6-(4-methyl-3-nitrobenzoyl)-2,5-dihydro-1H-azepino[4,5-b]indole-5-carboxylate |
| SMILES | CCOC(=O)C1C=NCCc2c1n(C(=O)c1ccc(C)c([N+](=O)[O-])c1)c1ccccc21 |
| InChI | InChI=1S/C23H21N3O5/c1-3-31-23(28)18-13-24-11-10-17-16-6-4-5-7-19(16)25(21(17)18)22(27)15-9-8-14(2)20(12-15)26(29)30/h4-9,12-13,18H,3,10-11H2,1-2H3 |
| InChIKey | KPVNVFLMCMIFTL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|