C20H29N — CID 123726238
N-(2-cyclohexa-1,3-dien-1-ylethenyl)-4-methyl-N-penta-2,4-dien-2-ylhex-1-en-2-amine (PubChem CID 123726238) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is N-(2-cyclohexa-1,3-dien-1-ylethenyl)-4-methyl-N-penta-2,4-dien-2-ylhex-1-en-2-amine.
| Compound Name | N-(2-cyclohexa-1,3-dien-1-ylethenyl)-4-methyl-N-penta-2,4-dien-2-ylhex-1-en-2-amine |
|---|---|
| PubChem CID | 123726238 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | N-(2-cyclohexa-1,3-dien-1-ylethenyl)-4-methyl-N-penta-2,4-dien-2-ylhex-1-en-2-amine |
| SMILES | C=CC=C(C)N(C=CC1=CC=CCC1)C(=C)CC(C)CC |
| InChI | InChI=1S/C20H29N/c1-6-11-18(4)21(19(5)16-17(3)7-2)15-14-20-12-9-8-10-13-20/h6,8-9,11-12,14-15,17H,1,5,7,10,13,16H2,2-4H3 |
| InChIKey | TXUHPGWNNZBWFS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|