C9H18N2 — CID 123727003
3-ethenyl-N',N'-dimethylpent-2-ene-1,5-diamine (PubChem CID 123727003) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-ethenyl-N',N'-dimethylpent-2-ene-1,5-diamine.
| Compound Name | 3-ethenyl-N',N'-dimethylpent-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 123727003 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-ethenyl-N',N'-dimethylpent-2-ene-1,5-diamine |
| SMILES | C=CC(=CCN)CCN(C)C |
| InChI | InChI=1S/C9H18N2/c1-4-9(5-7-10)6-8-11(2)3/h4-5H,1,6-8,10H2,2-3H3 |
| InChIKey | CXFPZFFEFYIWDD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|