C13H22FN — CID 143346303
(E)-2-but-2-enyl-5-fluoro-N,5-dimethyl-4-methylidenehex-2-en-1-amine (PubChem CID 143346303) has the molecular formula C13H22FN and a molecular weight of 211.32 g/mol. Its IUPAC name is (E)-2-but-2-enyl-5-fluoro-N,5-dimethyl-4-methylidenehex-2-en-1-amine.
| Compound Name | (E)-2-but-2-enyl-5-fluoro-N,5-dimethyl-4-methylidenehex-2-en-1-amine |
|---|---|
| PubChem CID | 143346303 |
| Molecular Formula | C13H22FN |
| Molecular Weight | 211.32 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | (E)-2-but-2-enyl-5-fluoro-N,5-dimethyl-4-methylidenehex-2-en-1-amine |
| SMILES | C=C(/C=C(\CC=CC)CNC)C(C)(C)F |
| InChI | InChI=1S/C13H22FN/c1-6-7-8-12(10-15-5)9-11(2)13(3,4)14/h6-7,9,15H,2,8,10H2,1,3-5H3/b7-6?,12-9+ |
| InChIKey | GPLDXSLBCWHMJD-VVQZTGQSSA-N |
| XLogP | 3.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|