C10H16FN — CID 143002647
4-[(Z)-but-1-enyl]-2-fluoro-5-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 143002647) has the molecular formula C10H16FN and a molecular weight of 169.24 g/mol. Its IUPAC name is 4-[(Z)-but-1-enyl]-2-fluoro-5-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-[(Z)-but-1-enyl]-2-fluoro-5-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 143002647 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 4-[(Z)-but-1-enyl]-2-fluoro-5-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CC/C=C\C1=C(C)CNC(F)C1 |
| InChI | InChI=1S/C10H16FN/c1-3-4-5-9-6-10(11)12-7-8(9)2/h4-5,10,12H,3,6-7H2,1-2H3/b5-4- |
| InChIKey | HXMLXYDLXSXFLM-PLNGDYQASA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|