C41H33N5O10 — CID 123727025
3-[5-[[5-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-2,3-dimethoxyphenoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione (PubChem CID 123727025) has the molecular formula C41H33N5O10 and a molecular weight of 755.74 g/mol. Its IUPAC name is 3-[5-[[5-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-2,3-dimethoxyphenoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[5-[[5-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-2,3-dimethoxyphenoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 123727025 |
| Molecular Formula | C41H33N5O10 |
| Molecular Weight | 755.74 g/mol |
| Exact Mass | 755.22 |
| IUPAC Name | 3-[5-[[5-[4-(1H-indol-3-yl)-2,5-dioxopyrrol-3-yl]-2,3-dimethoxyphenoxy]methyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-4-(3,4,5-trimethoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1cc(C2=C(c3c[nH]c4ncc(COc5cc(C6=C(c7c[nH]c8ccccc78)C(=O)NC6=O)cc(OC)c5OC)cc34)C(=O)NC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C41H33N5O10/c1-51-27-11-20(12-28(52-2)35(27)54-4)31-34(41(50)46-38(31)47)25-17-44-37-23(25)10-19(15-43-37)18-56-30-14-21(13-29(53-3)36(30)55-5)32-33(40(49)45-39(32)48)24-16-42-26-9-7-6-8-22(24)26/h6-17,42H,18H2,1-5H3,(H,43,44)(H,45,48,49)(H,46,47,50) |
| InChIKey | GQICAIMQJIJWST-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.74 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|