C18H25N3O — CID 123729036
1-(5-benzyl-6-imino-2,3-dihydropyrazin-1-yl)-2-methylhexan-1-one (PubChem CID 123729036) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is 1-(5-benzyl-6-imino-2,3-dihydropyrazin-1-yl)-2-methylhexan-1-one.
| Compound Name | 1-(5-benzyl-6-imino-2,3-dihydropyrazin-1-yl)-2-methylhexan-1-one |
|---|---|
| PubChem CID | 123729036 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-(5-benzyl-6-imino-2,3-dihydropyrazin-1-yl)-2-methylhexan-1-one |
| SMILES | [H]/N=C1\C(Cc2ccccc2)=NCCN1C(=O)C(C)CCCC |
| InChI | InChI=1S/C18H25N3O/c1-3-4-8-14(2)18(22)21-12-11-20-16(17(21)19)13-15-9-6-5-7-10-15/h5-7,9-10,14,19H,3-4,8,11-13H2,1-2H3/b19-17+ |
| InChIKey | SLUHKAYWWCXKKE-HTXNQAPBSA-N |
| XLogP | 3.32 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|