C12H6Cl2N3+ — CID 123730063
1,7-dichloro-5H-pyrido[4,3-b]indol-2-ium-4-carbonitrile (PubChem CID 123730063) has the molecular formula C12H6Cl2N3+ and a molecular weight of 263.11 g/mol. Its IUPAC name is 1,7-dichloro-5H-pyrido[4,3-b]indol-2-ium-4-carbonitrile.
| Compound Name | 1,7-dichloro-5H-pyrido[4,3-b]indol-2-ium-4-carbonitrile |
|---|---|
| PubChem CID | 123730063 |
| Molecular Formula | C12H6Cl2N3+ |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 261.99 |
| IUPAC Name | 1,7-dichloro-5H-pyrido[4,3-b]indol-2-ium-4-carbonitrile |
| SMILES | N#Cc1c[nH+]c(Cl)c2c1[nH]c1cc(Cl)ccc12 |
| InChI | InChI=1S/C12H5Cl2N3/c13-7-1-2-8-9(3-7)17-11-6(4-15)5-16-12(14)10(8)11/h1-3,5,17H/p+1 |
| InChIKey | VHGGBJVGTYVBTG-UHFFFAOYSA-O |
| XLogP | 3.31 |
| TPSA | 53.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|