About N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide
N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide (PubChem CID 123734495) has the molecular formula C8H12FN3
and a molecular weight of 169.20 g/mol. Its IUPAC name is N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide.
Molecular Properties
| Compound Name | N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide |
| PubChem CID | 123734495 |
| Molecular Formula | C8H12FN3 |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.10 |
| IUPAC Name | N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide |
| SMILES | [H]/N=C(C)/C(/C=C/N=C(\C)N)=C/F |
| InChI | InChI=1S/C8H12FN3/c1-6(10)8(5-9)3-4-12-7(2)11/h3-5,10H,1-2H3,(H2,11,12)/b4-3+,8-5+,10-6+ |
| InChIKey | OGYDYKBQVJJCJD-IZMYCKBJSA-N |
| XLogP | 1.77 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide?
The IUPAC name of N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide (CID 123734495) is N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide.
What is the SMILES notation for N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide?
The canonical SMILES for N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide is [H]/N=C(C)/C(/C=C/N=C(\C)N)=C/F.
What is the InChIKey of N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide?
The InChIKey is OGYDYKBQVJJCJD-IZMYCKBJSA-N. The full InChI is InChI=1S/C8H12FN3/c1-6(10)8(5-9)3-4-12-7(2)11/h3-5,10H,1-2H3,(H2,11,12)/b4-3+,8-5+,10-6+.
What are the key properties of N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide?
N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide has a molecular weight of 169.20 g/mol, XLogP of 1.77, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E,3E)-3-(fluoromethylidene)-4-iminopent-1-enyl]ethanimidamide is sourced from PubChem (CID 123734495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).