C39H53NO — CID 123735443
6,9-bis(4-tert-butylphenyl)-5-ethyl-4-(6-methoxyhexyl)-4,5-dihydro-3H-2-benzazepine (PubChem CID 123735443) has the molecular formula C39H53NO and a molecular weight of 551.86 g/mol. Its IUPAC name is 6,9-bis(4-tert-butylphenyl)-5-ethyl-4-(6-methoxyhexyl)-4,5-dihydro-3H-2-benzazepine.
| Compound Name | 6,9-bis(4-tert-butylphenyl)-5-ethyl-4-(6-methoxyhexyl)-4,5-dihydro-3H-2-benzazepine |
|---|---|
| PubChem CID | 123735443 |
| Molecular Formula | C39H53NO |
| Molecular Weight | 551.86 g/mol |
| Exact Mass | 551.41 |
| IUPAC Name | 6,9-bis(4-tert-butylphenyl)-5-ethyl-4-(6-methoxyhexyl)-4,5-dihydro-3H-2-benzazepine |
| SMILES | CCC1c2c(-c3ccc(C(C)(C)C)cc3)ccc(-c3ccc(C(C)(C)C)cc3)c2C=NCC1CCCCCCOC |
| InChI | InChI=1S/C39H53NO/c1-9-33-30(14-12-10-11-13-25-41-8)26-40-27-36-34(28-15-19-31(20-16-28)38(2,3)4)23-24-35(37(33)36)29-17-21-32(22-18-29)39(5,6)7/h15-24,27,30,33H,9-14,25-26H2,1-8H3 |
| InChIKey | MGBSSUYSFFQPJM-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.86 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|