C35H43N — CID 143072138
(2E)-N-[4-(2,4-dimethylphenyl)-2-methylidenebutyl]-4-methyl-2,3-bis(4-methylphenyl)penta-2,4-dien-1-imine;ethane (PubChem CID 143072138) has the molecular formula C35H43N and a molecular weight of 477.74 g/mol. Its IUPAC name is (2E)-N-[4-(2,4-dimethylphenyl)-2-methylidenebutyl]-4-methyl-2,3-bis(4-methylphenyl)penta-2,4-dien-1-imine;ethane.
| Compound Name | (2E)-N-[4-(2,4-dimethylphenyl)-2-methylidenebutyl]-4-methyl-2,3-bis(4-methylphenyl)penta-2,4-dien-1-imine;ethane |
|---|---|
| PubChem CID | 143072138 |
| Molecular Formula | C35H43N |
| Molecular Weight | 477.74 g/mol |
| Exact Mass | 477.34 |
| IUPAC Name | (2E)-N-[4-(2,4-dimethylphenyl)-2-methylidenebutyl]-4-methyl-2,3-bis(4-methylphenyl)penta-2,4-dien-1-imine;ethane |
| SMILES | C=C(CCc1ccc(C)cc1C)C/N=C/C(=C(\C(=C)C)c1ccc(C)cc1)c1ccc(C)cc1.CC |
| InChI | InChI=1S/C33H37N.C2H6/c1-23(2)33(31-18-10-25(4)11-19-31)32(30-16-8-24(3)9-17-30)22-34-21-27(6)13-15-29-14-12-26(5)20-28(29)7;1-2/h8-12,14,16-20,22H,1,6,13,15,21H2,2-5,7H3;1-2H3/b33-32-,34-22+; |
| InChIKey | CKCYVZHODSRXLF-MGGPEGNGSA-N |
| XLogP | 9.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.74 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|