C29H36F3N — CID 91408250
N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-1-[4-(2,2,2-trifluoroethyl)phenyl]methanimine (PubChem CID 91408250) has the molecular formula C29H36F3N and a molecular weight of 455.61 g/mol. Its IUPAC name is N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-1-[4-(2,2,2-trifluoroethyl)phenyl]methanimine.
| Compound Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-1-[4-(2,2,2-trifluoroethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 91408250 |
| Molecular Formula | C29H36F3N |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | N-[(1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl)methyl]-1-[4-(2,2,2-trifluoroethyl)phenyl]methanimine |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(C/N=C/c3ccc(CC(F)(F)F)cc3)CCCC21C |
| InChI | InChI=1S/C29H36F3N/c1-20(2)23-10-12-25-24(16-23)11-13-26-27(3,14-5-15-28(25,26)4)19-33-18-22-8-6-21(7-9-22)17-29(30,31)32/h6-10,12,16,18,20,26H,5,11,13-15,17,19H2,1-4H3/b33-18+ |
| InChIKey | TXQDXSARGMOZJA-DPNNOFEESA-N |
| XLogP | 8.04 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|