C15H28F2O — CID 123735951
8,9-difluoro-10-methoxy-3,6,7-trimethylundec-1-ene (PubChem CID 123735951) has the molecular formula C15H28F2O and a molecular weight of 262.38 g/mol. Its IUPAC name is 8,9-difluoro-10-methoxy-3,6,7-trimethylundec-1-ene.
| Compound Name | 8,9-difluoro-10-methoxy-3,6,7-trimethylundec-1-ene |
|---|---|
| PubChem CID | 123735951 |
| Molecular Formula | C15H28F2O |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 8,9-difluoro-10-methoxy-3,6,7-trimethylundec-1-ene |
| SMILES | C=CC(C)CCC(C)C(C)C(F)C(F)C(C)OC |
| InChI | InChI=1S/C15H28F2O/c1-7-10(2)8-9-11(3)12(4)14(16)15(17)13(5)18-6/h7,10-15H,1,8-9H2,2-6H3 |
| InChIKey | JADXOKBNIRJPNA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|