C21H32N2O7 — CID 123735986
(2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-(3-methyl-3-prop-2-ynoxybutoxy)butyl]amino]-4-oxobutanoate (PubChem CID 123735986) has the molecular formula C21H32N2O7 and a molecular weight of 424.49 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-(3-methyl-3-prop-2-ynoxybutoxy)butyl]amino]-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-(3-methyl-3-prop-2-ynoxybutoxy)butyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123735986 |
| Molecular Formula | C21H32N2O7 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-(3-methyl-3-prop-2-ynoxybutoxy)butyl]amino]-4-oxobutanoate |
| SMILES | C#CCOC(C)(C)CCOC(C)(C)CCNC(=O)CCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C21H32N2O7/c1-6-14-28-21(4,5)12-15-29-20(2,3)11-13-22-16(24)7-10-19(27)30-23-17(25)8-9-18(23)26/h1,8-9,25-26H,7,10-15H2,2-5H3,(H,22,24) |
| InChIKey | HKZXNTSWJSKQMG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|