C44H53NO2 — CID 123737632
5-[3-(2-cyclopropylethylimino)propyl]-1-[6-(3-methylbutyl)naphthalen-2-yl]-9-(4-phenylphenyl)nonane-1,6-dione (PubChem CID 123737632) has the molecular formula C44H53NO2 and a molecular weight of 627.91 g/mol. Its IUPAC name is 5-[3-(2-cyclopropylethylimino)propyl]-1-[6-(3-methylbutyl)naphthalen-2-yl]-9-(4-phenylphenyl)nonane-1,6-dione.
| Compound Name | 5-[3-(2-cyclopropylethylimino)propyl]-1-[6-(3-methylbutyl)naphthalen-2-yl]-9-(4-phenylphenyl)nonane-1,6-dione |
|---|---|
| PubChem CID | 123737632 |
| Molecular Formula | C44H53NO2 |
| Molecular Weight | 627.91 g/mol |
| Exact Mass | 627.41 |
| IUPAC Name | 5-[3-(2-cyclopropylethylimino)propyl]-1-[6-(3-methylbutyl)naphthalen-2-yl]-9-(4-phenylphenyl)nonane-1,6-dione |
| SMILES | CC(C)CCc1ccc2cc(C(=O)CCCC(CC/C=N/CCC3CC3)C(=O)CCCc3ccc(-c4ccccc4)cc3)ccc2c1 |
| InChI | InChI=1S/C44H53NO2/c1-33(2)16-17-36-22-25-41-32-42(27-26-40(41)31-36)44(47)15-7-12-39(13-8-29-45-30-28-35-18-19-35)43(46)14-6-9-34-20-23-38(24-21-34)37-10-4-3-5-11-37/h3-5,10-11,20-27,29,31-33,35,39H,6-9,12-19,28,30H2,1-2H3/b45-29+ |
| InChIKey | IMXFYUQYNZZBPV-RBFPZZGSSA-N |
| XLogP | 11.31 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.91 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|