C22H26F3N4O2+ — CID 123737726
2-[4-[[3-[3-(trifluoromethoxy)phenyl]-3aH-pyrazolo[1,5-a]pyrimidin-8-ium-5-yl]amino]cyclohexyl]propan-2-ol (PubChem CID 123737726) has the molecular formula C22H26F3N4O2+ and a molecular weight of 435.47 g/mol. Its IUPAC name is 2-[4-[[3-[3-(trifluoromethoxy)phenyl]-3aH-pyrazolo[1,5-a]pyrimidin-8-ium-5-yl]amino]cyclohexyl]propan-2-ol.
| Compound Name | 2-[4-[[3-[3-(trifluoromethoxy)phenyl]-3aH-pyrazolo[1,5-a]pyrimidin-8-ium-5-yl]amino]cyclohexyl]propan-2-ol |
|---|---|
| PubChem CID | 123737726 |
| Molecular Formula | C22H26F3N4O2+ |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 2-[4-[[3-[3-(trifluoromethoxy)phenyl]-3aH-pyrazolo[1,5-a]pyrimidin-8-ium-5-yl]amino]cyclohexyl]propan-2-ol |
| SMILES | CC(C)(O)C1CCC(NC2=NC3C(c4cccc(OC(F)(F)F)c4)=CN=[N+]3C=C2)CC1 |
| InChI | InChI=1S/C22H26F3N4O2/c1-21(2,30)15-6-8-16(9-7-15)27-19-10-11-29-20(28-19)18(13-26-29)14-4-3-5-17(12-14)31-22(23,24)25/h3-5,10-13,15-16,20,30H,6-9H2,1-2H3,(H,27,28)/q+1 |
| InChIKey | XGVTWALZUPRCMN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|