About 4-chloro-5,5-dimethylcyclohex-2-en-1-imine
4-chloro-5,5-dimethylcyclohex-2-en-1-imine (PubChem CID 123737863) has the molecular formula C8H12ClN
and a molecular weight of 157.64 g/mol. Its IUPAC name is 4-chloro-5,5-dimethylcyclohex-2-en-1-imine.
Molecular Properties
| Compound Name | 4-chloro-5,5-dimethylcyclohex-2-en-1-imine |
| PubChem CID | 123737863 |
| Molecular Formula | C8H12ClN |
| Molecular Weight | 157.64 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 4-chloro-5,5-dimethylcyclohex-2-en-1-imine |
| SMILES | [H]/N=C1\C=CC(Cl)C(C)(C)C1 |
| InChI | InChI=1S/C8H12ClN/c1-8(2)5-6(10)3-4-7(8)9/h3-4,7,10H,5H2,1-2H3/b10-6+ |
| InChIKey | NGYYKKVNYQYZMA-UXBLZVDNSA-N |
| XLogP | 2.60 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.64 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-5,5-dimethylcyclohex-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5,5-dimethylcyclohex-2-en-1-imine?
The IUPAC name of 4-chloro-5,5-dimethylcyclohex-2-en-1-imine (CID 123737863) is 4-chloro-5,5-dimethylcyclohex-2-en-1-imine.
What is the SMILES notation for 4-chloro-5,5-dimethylcyclohex-2-en-1-imine?
The canonical SMILES for 4-chloro-5,5-dimethylcyclohex-2-en-1-imine is [H]/N=C1\C=CC(Cl)C(C)(C)C1.
What is the InChIKey of 4-chloro-5,5-dimethylcyclohex-2-en-1-imine?
The InChIKey is NGYYKKVNYQYZMA-UXBLZVDNSA-N. The full InChI is InChI=1S/C8H12ClN/c1-8(2)5-6(10)3-4-7(8)9/h3-4,7,10H,5H2,1-2H3/b10-6+.
What are the key properties of 4-chloro-5,5-dimethylcyclohex-2-en-1-imine?
4-chloro-5,5-dimethylcyclohex-2-en-1-imine has a molecular weight of 157.64 g/mol, XLogP of 2.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5,5-dimethylcyclohex-2-en-1-imine is sourced from PubChem (CID 123737863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).