C5H10N2O — CID 123739279
3-ethyl-4-methyl-5H-1,2,4-oxadiazole (PubChem CID 123739279) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is 3-ethyl-4-methyl-5H-1,2,4-oxadiazole.
| Compound Name | 3-ethyl-4-methyl-5H-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 123739279 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 3-ethyl-4-methyl-5H-1,2,4-oxadiazole |
| SMILES | CCC1=NOCN1C |
| InChI | InChI=1S/C5H10N2O/c1-3-5-6-8-4-7(5)2/h3-4H2,1-2H3 |
| InChIKey | VQRZXXYMXFVPOF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |