C9H18N2 — CID 66631509
1-ethyl-2-propyl-5,6-dihydro-4H-pyrimidine (PubChem CID 66631509) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is 1-ethyl-2-propyl-5,6-dihydro-4H-pyrimidine.
| Compound Name | 1-ethyl-2-propyl-5,6-dihydro-4H-pyrimidine |
|---|---|
| PubChem CID | 66631509 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 1-ethyl-2-propyl-5,6-dihydro-4H-pyrimidine |
| SMILES | CCCC1=NCCCN1CC |
| InChI | InChI=1S/C9H18N2/c1-3-6-9-10-7-5-8-11(9)4-2/h3-8H2,1-2H3 |
| InChIKey | NTCVBYCDNOJYGK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |