C14H23N3 — CID 123740244
N-[2-ethyl-1-(2-propan-2-yl-3,4-dihydropyrazol-3-yl)penta-1,3-dienyl]methanimine (PubChem CID 123740244) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N-[2-ethyl-1-(2-propan-2-yl-3,4-dihydropyrazol-3-yl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[2-ethyl-1-(2-propan-2-yl-3,4-dihydropyrazol-3-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 123740244 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N-[2-ethyl-1-(2-propan-2-yl-3,4-dihydropyrazol-3-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=NC(=C(C=CC)CC)C1CC=NN1C(C)C |
| InChI | InChI=1S/C14H23N3/c1-6-8-12(7-2)14(15-5)13-9-10-16-17(13)11(3)4/h6,8,10-11,13H,5,7,9H2,1-4H3 |
| InChIKey | OUBUORKLZPQJNR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|