C12H17BrN2O2S — CID 123740260
4-bromo-1-[cyclobutylmethyl(sulfino)amino]-2-(methylamino)benzene (PubChem CID 123740260) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is 4-bromo-1-[cyclobutylmethyl(sulfino)amino]-2-(methylamino)benzene.
| Compound Name | 4-bromo-1-[cyclobutylmethyl(sulfino)amino]-2-(methylamino)benzene |
|---|---|
| PubChem CID | 123740260 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 4-bromo-1-[cyclobutylmethyl(sulfino)amino]-2-(methylamino)benzene |
| SMILES | CNc1cc(Br)ccc1N(CC1CCC1)S(=O)O |
| InChI | InChI=1S/C12H17BrN2O2S/c1-14-11-7-10(13)5-6-12(11)15(18(16)17)8-9-3-2-4-9/h5-7,9,14H,2-4,8H2,1H3,(H,16,17) |
| InChIKey | DHHBXKZOWHTFNN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|