C9H13BrN2O — CID 167186750
4-bromo-1-N-methoxy-1-N,2-N-dimethylbenzene-1,2-diamine (PubChem CID 167186750) has the molecular formula C9H13BrN2O and a molecular weight of 245.12 g/mol. Its IUPAC name is 4-bromo-1-N-methoxy-1-N,2-N-dimethylbenzene-1,2-diamine.
| Compound Name | 4-bromo-1-N-methoxy-1-N,2-N-dimethylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 167186750 |
| Molecular Formula | C9H13BrN2O |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 4-bromo-1-N-methoxy-1-N,2-N-dimethylbenzene-1,2-diamine |
| SMILES | CNc1cc(Br)ccc1N(C)OC |
| InChI | InChI=1S/C9H13BrN2O/c1-11-8-6-7(10)4-5-9(8)12(2)13-3/h4-6,11H,1-3H3 |
| InChIKey | HIPFRWXHYVFXPW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|