C39H40Cl2N4O8S — CID 123741704
[2-[2-(4-benzylsulfonylpiperazin-1-yl)-4-chlorophenoxy]acetyl] 2-[4-chloro-2-[4-(2-phenylacetyl)piperazin-1-yl]phenoxy]acetate (PubChem CID 123741704) has the molecular formula C39H40Cl2N4O8S and a molecular weight of 795.74 g/mol. Its IUPAC name is [2-[2-(4-benzylsulfonylpiperazin-1-yl)-4-chlorophenoxy]acetyl] 2-[4-chloro-2-[4-(2-phenylacetyl)piperazin-1-yl]phenoxy]acetate.
| Compound Name | [2-[2-(4-benzylsulfonylpiperazin-1-yl)-4-chlorophenoxy]acetyl] 2-[4-chloro-2-[4-(2-phenylacetyl)piperazin-1-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 123741704 |
| Molecular Formula | C39H40Cl2N4O8S |
| Molecular Weight | 795.74 g/mol |
| Exact Mass | 794.19 |
| IUPAC Name | [2-[2-(4-benzylsulfonylpiperazin-1-yl)-4-chlorophenoxy]acetyl] 2-[4-chloro-2-[4-(2-phenylacetyl)piperazin-1-yl]phenoxy]acetate |
| SMILES | O=C(COc1ccc(Cl)cc1N1CCN(C(=O)Cc2ccccc2)CC1)OC(=O)COc1ccc(Cl)cc1N1CCN(S(=O)(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C39H40Cl2N4O8S/c40-31-11-13-35(33(24-31)42-15-17-44(18-16-42)37(46)23-29-7-3-1-4-8-29)51-26-38(47)53-39(48)27-52-36-14-12-32(41)25-34(36)43-19-21-45(22-20-43)54(49,50)28-30-9-5-2-6-10-30/h1-14,24-25H,15-23,26-28H2 |
| InChIKey | VQRRJZZGSNZERZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 126.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.74 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|