C9H14FN3O4 — CID 123741792
4-amino-1-[2-fluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one (PubChem CID 123741792) has the molecular formula C9H14FN3O4 and a molecular weight of 247.23 g/mol. Its IUPAC name is 4-amino-1-[2-fluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[2-fluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 123741792 |
| Molecular Formula | C9H14FN3O4 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-amino-1-[2-fluoro-3-hydroxy-1-(2-hydroxyethoxy)propyl]pyrimidin-2-one |
| SMILES | Nc1ccn(C(OCCO)C(F)CO)c(=O)n1 |
| InChI | InChI=1S/C9H14FN3O4/c10-6(5-15)8(17-4-3-14)13-2-1-7(11)12-9(13)16/h1-2,6,8,14-15H,3-5H2,(H2,11,12,16) |
| InChIKey | ZIHQJMMHOASEDO-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |