C7H20O3Si3 — CID 123745447
bis(dimethylsilyloxy)-hydroxy-prop-2-enylsilane (PubChem CID 123745447) has the molecular formula C7H20O3Si3 and a molecular weight of 236.49 g/mol. Its IUPAC name is bis(dimethylsilyloxy)-hydroxy-prop-2-enylsilane.
| Compound Name | bis(dimethylsilyloxy)-hydroxy-prop-2-enylsilane |
|---|---|
| PubChem CID | 123745447 |
| Molecular Formula | C7H20O3Si3 |
| Molecular Weight | 236.49 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | bis(dimethylsilyloxy)-hydroxy-prop-2-enylsilane |
| SMILES | C=CC[Si](O)(O[SiH](C)C)O[SiH](C)C |
| InChI | InChI=1S/C7H20O3Si3/c1-6-7-13(8,9-11(2)3)10-12(4)5/h6,8,11-12H,1,7H2,2-5H3 |
| InChIKey | KIWDVYQEHNOQAU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.49 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|