C12H12BrF3N2O2 — CID 123745464
1-(4-amino-3-bromophenyl)-4,4,4-trifluoro-3-methyl-3-(nitrosomethyl)butan-1-one (PubChem CID 123745464) has the molecular formula C12H12BrF3N2O2 and a molecular weight of 353.14 g/mol. Its IUPAC name is 1-(4-amino-3-bromophenyl)-4,4,4-trifluoro-3-methyl-3-(nitrosomethyl)butan-1-one.
| Compound Name | 1-(4-amino-3-bromophenyl)-4,4,4-trifluoro-3-methyl-3-(nitrosomethyl)butan-1-one |
|---|---|
| PubChem CID | 123745464 |
| Molecular Formula | C12H12BrF3N2O2 |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 1-(4-amino-3-bromophenyl)-4,4,4-trifluoro-3-methyl-3-(nitrosomethyl)butan-1-one |
| SMILES | CC(CN=O)(CC(=O)c1ccc(N)c(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C12H12BrF3N2O2/c1-11(6-18-20,12(14,15)16)5-10(19)7-2-3-9(17)8(13)4-7/h2-4H,5-6,17H2,1H3 |
| InChIKey | LLIJWVBVMXCPQZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|