C9H14N2O3 — CID 123746546
3-(2,5-dihydroxypyrrol-1-yl)-N-ethylpropanamide (PubChem CID 123746546) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-(2,5-dihydroxypyrrol-1-yl)-N-ethylpropanamide.
| Compound Name | 3-(2,5-dihydroxypyrrol-1-yl)-N-ethylpropanamide |
|---|---|
| PubChem CID | 123746546 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-(2,5-dihydroxypyrrol-1-yl)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCn1c(O)ccc1O |
| InChI | InChI=1S/C9H14N2O3/c1-2-10-7(12)5-6-11-8(13)3-4-9(11)14/h3-4,13-14H,2,5-6H2,1H3,(H,10,12) |
| InChIKey | PYJFFGHCCLOSAX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |