About 5H-thieno[3,2-c]pyridine 1-oxide
5H-thieno[3,2-c]pyridine 1-oxide (PubChem CID 123746872) has the molecular formula C7H6NOS-
and a molecular weight of 152.20 g/mol. Its IUPAC name is 5H-thieno[3,2-c]pyridine 1-oxide.
Molecular Properties
| Compound Name | 5H-thieno[3,2-c]pyridine 1-oxide |
| PubChem CID | 123746872 |
| Molecular Formula | C7H6NOS- |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 5H-thieno[3,2-c]pyridine 1-oxide |
| SMILES | O=[S-]1=C2C=CNC=C2C=C1 |
| InChI | InChI=1S/C7H6NOS/c9-10-4-2-6-5-8-3-1-7(6)10/h1-5,8H/q-1 |
| InChIKey | XMHZEETWHRCAKP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thio_dibenzo(23)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 5H-thieno[3,2-c]pyridine 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-thieno[3,2-c]pyridine 1-oxide?
The IUPAC name of 5H-thieno[3,2-c]pyridine 1-oxide (CID 123746872) is 5H-thieno[3,2-c]pyridine 1-oxide.
What is the SMILES notation for 5H-thieno[3,2-c]pyridine 1-oxide?
The canonical SMILES for 5H-thieno[3,2-c]pyridine 1-oxide is O=[S-]1=C2C=CNC=C2C=C1.
What is the InChIKey of 5H-thieno[3,2-c]pyridine 1-oxide?
The InChIKey is XMHZEETWHRCAKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6NOS/c9-10-4-2-6-5-8-3-1-7(6)10/h1-5,8H/q-1.
What are the key properties of 5H-thieno[3,2-c]pyridine 1-oxide?
5H-thieno[3,2-c]pyridine 1-oxide has a molecular weight of 152.20 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-thieno[3,2-c]pyridine 1-oxide is sourced from PubChem (CID 123746872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).