About 6H-dithiolo[3,4-c]pyridine
6H-dithiolo[3,4-c]pyridine (PubChem CID 142421417) has the molecular formula C6H5NS2
and a molecular weight of 155.25 g/mol. Its IUPAC name is 6H-dithiolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 6H-dithiolo[3,4-c]pyridine |
| PubChem CID | 142421417 |
| Molecular Formula | C6H5NS2 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 154.99 |
| IUPAC Name | 6H-dithiolo[3,4-c]pyridine |
| SMILES | C1=CC2=CSSC2=CN1 |
| InChI | InChI=1S/C6H5NS2/c1-2-7-3-6-5(1)4-8-9-6/h1-4,7H |
| InChIKey | VXFRYSWPVYYOAA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 6H-dithiolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-dithiolo[3,4-c]pyridine?
The IUPAC name of 6H-dithiolo[3,4-c]pyridine (CID 142421417) is 6H-dithiolo[3,4-c]pyridine.
What is the SMILES notation for 6H-dithiolo[3,4-c]pyridine?
The canonical SMILES for 6H-dithiolo[3,4-c]pyridine is C1=CC2=CSSC2=CN1.
What is the InChIKey of 6H-dithiolo[3,4-c]pyridine?
The InChIKey is VXFRYSWPVYYOAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NS2/c1-2-7-3-6-5(1)4-8-9-6/h1-4,7H.
What are the key properties of 6H-dithiolo[3,4-c]pyridine?
6H-dithiolo[3,4-c]pyridine has a molecular weight of 155.25 g/mol, XLogP of 2.22, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-dithiolo[3,4-c]pyridine is sourced from PubChem (CID 142421417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).