About 4,7-dihydro-3H-dithiolo[3,4-b]pyridine
4,7-dihydro-3H-dithiolo[3,4-b]pyridine (PubChem CID 169224140) has the molecular formula C6H7NS2
and a molecular weight of 157.26 g/mol. Its IUPAC name is 4,7-dihydro-3H-dithiolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4,7-dihydro-3H-dithiolo[3,4-b]pyridine |
| PubChem CID | 169224140 |
| Molecular Formula | C6H7NS2 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.00 |
| IUPAC Name | 4,7-dihydro-3H-dithiolo[3,4-b]pyridine |
| SMILES | C1=CNC2=C(C1)CSS2 |
| InChI | InChI=1S/C6H7NS2/c1-2-5-4-8-9-6(5)7-3-1/h1,3,7H,2,4H2 |
| InChIKey | MFASCUXRIJAZSL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dihydro-3H-dithiolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dihydro-3H-dithiolo[3,4-b]pyridine?
The IUPAC name of 4,7-dihydro-3H-dithiolo[3,4-b]pyridine (CID 169224140) is 4,7-dihydro-3H-dithiolo[3,4-b]pyridine.
What is the SMILES notation for 4,7-dihydro-3H-dithiolo[3,4-b]pyridine?
The canonical SMILES for 4,7-dihydro-3H-dithiolo[3,4-b]pyridine is C1=CNC2=C(C1)CSS2.
What is the InChIKey of 4,7-dihydro-3H-dithiolo[3,4-b]pyridine?
The InChIKey is MFASCUXRIJAZSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NS2/c1-2-5-4-8-9-6(5)7-3-1/h1,3,7H,2,4H2.
What are the key properties of 4,7-dihydro-3H-dithiolo[3,4-b]pyridine?
4,7-dihydro-3H-dithiolo[3,4-b]pyridine has a molecular weight of 157.26 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dihydro-3H-dithiolo[3,4-b]pyridine is sourced from PubChem (CID 169224140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).