C6H11FN2 — CID 123747241
3-N-(2-fluoroethyl)butane-1,3-diimine (PubChem CID 123747241) has the molecular formula C6H11FN2 and a molecular weight of 130.17 g/mol. Its IUPAC name is 3-N-(2-fluoroethyl)butane-1,3-diimine.
| Compound Name | 3-N-(2-fluoroethyl)butane-1,3-diimine |
|---|---|
| PubChem CID | 123747241 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 3-N-(2-fluoroethyl)butane-1,3-diimine |
| SMILES | [H]/N=C/C/C(C)=N/CCF |
| InChI | InChI=1S/C6H11FN2/c1-6(2-4-8)9-5-3-7/h4,8H,2-3,5H2,1H3/b8-4+,9-6+ |
| InChIKey | INPUOXLHZJJQES-HNJDCKIISA-N |
| XLogP | 1.46 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|