C13H20N2 — CID 123747560
(4Z)-5-ethenyl-4-N-ethylidene-3-N,6-dimethylhepta-4,6-diene-3,4-diimine (PubChem CID 123747560) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (4Z)-5-ethenyl-4-N-ethylidene-3-N,6-dimethylhepta-4,6-diene-3,4-diimine.
| Compound Name | (4Z)-5-ethenyl-4-N-ethylidene-3-N,6-dimethylhepta-4,6-diene-3,4-diimine |
|---|---|
| PubChem CID | 123747560 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (4Z)-5-ethenyl-4-N-ethylidene-3-N,6-dimethylhepta-4,6-diene-3,4-diimine |
| SMILES | C=C/C(C(=C)C)=C(/N=C/C)C(\CC)=N\C |
| InChI | InChI=1S/C13H20N2/c1-7-11(10(4)5)13(15-9-3)12(8-2)14-6/h7,9H,1,4,8H2,2-3,5-6H3/b13-11-,14-12+,15-9+ |
| InChIKey | PJTVBTDJAATXBG-ZKTKIUAPSA-N |
| XLogP | 3.57 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|