C21H16F4N5O2+ — CID 123751128
[2-[[4-fluoro-6-(2-methylbenzimidazol-1-yl)-2-pyridinyl]amino]-5-(trifluoromethyl)phenyl]-methoxy-oxoazanium (PubChem CID 123751128) has the molecular formula C21H16F4N5O2+ and a molecular weight of 446.38 g/mol. Its IUPAC name is [2-[[4-fluoro-6-(2-methylbenzimidazol-1-yl)-2-pyridinyl]amino]-5-(trifluoromethyl)phenyl]-methoxy-oxoazanium.
| Compound Name | [2-[[4-fluoro-6-(2-methylbenzimidazol-1-yl)-2-pyridinyl]amino]-5-(trifluoromethyl)phenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 123751128 |
| Molecular Formula | C21H16F4N5O2+ |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | [2-[[4-fluoro-6-(2-methylbenzimidazol-1-yl)-2-pyridinyl]amino]-5-(trifluoromethyl)phenyl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1cc(C(F)(F)F)ccc1Nc1cc(F)cc(-n2c(C)nc3ccccc32)n1 |
| InChI | InChI=1S/C21H16F4N5O2/c1-12-26-15-5-3-4-6-17(15)29(12)20-11-14(22)10-19(28-20)27-16-8-7-13(21(23,24)25)9-18(16)30(31)32-2/h3-11H,1-2H3,(H,27,28)/q+1 |
| InChIKey | XJWHGATZGRCXNE-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|