C21H25ClO7 — CID 123751327
[13-methyl-13-[2-(5-oxo-2H-furan-4-yl)ethyl]-6-propan-2-yl-2,5,9-trioxapentacyclo[6.5.0.01,3.04,6.08,10]tridecan-7-yl] carbonochloridate (PubChem CID 123751327) has the molecular formula C21H25ClO7 and a molecular weight of 424.88 g/mol. Its IUPAC name is [13-methyl-13-[2-(5-oxo-2H-furan-4-yl)ethyl]-6-propan-2-yl-2,5,9-trioxapentacyclo[6.5.0.01,3.04,6.08,10]tridecan-7-yl] carbonochloridate.
| Compound Name | [13-methyl-13-[2-(5-oxo-2H-furan-4-yl)ethyl]-6-propan-2-yl-2,5,9-trioxapentacyclo[6.5.0.01,3.04,6.08,10]tridecan-7-yl] carbonochloridate |
|---|---|
| PubChem CID | 123751327 |
| Molecular Formula | C21H25ClO7 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | [13-methyl-13-[2-(5-oxo-2H-furan-4-yl)ethyl]-6-propan-2-yl-2,5,9-trioxapentacyclo[6.5.0.01,3.04,6.08,10]tridecan-7-yl] carbonochloridate |
| SMILES | CC(C)C12OC1C1OC13C(C)(CCC1=CCOC1=O)CCC1OC13C2OC(=O)Cl |
| InChI | InChI=1S/C21H25ClO7/c1-10(2)19-13(28-19)14-21(29-14)18(3,7-4-11-6-9-25-15(11)23)8-5-12-20(21,27-12)16(19)26-17(22)24/h6,10,12-14,16H,4-5,7-9H2,1-3H3 |
| InChIKey | DBRGWZQFQDZXDB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|