C49H44S2 — CID 123754802
6-tert-butyl-15-methyl-9,9,18,18-tetrakis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene (PubChem CID 123754802) has the molecular formula C49H44S2 and a molecular weight of 697.02 g/mol. Its IUPAC name is 6-tert-butyl-15-methyl-9,9,18,18-tetrakis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene.
| Compound Name | 6-tert-butyl-15-methyl-9,9,18,18-tetrakis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
|---|---|
| PubChem CID | 123754802 |
| Molecular Formula | C49H44S2 |
| Molecular Weight | 697.02 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | 6-tert-butyl-15-methyl-9,9,18,18-tetrakis(4-methylphenyl)-5,14-dithiapentacyclo[10.6.0.03,10.04,8.013,17]octadeca-1,3(10),4(8),6,11,13(17),15-heptaene |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)c3cc4c(cc3-c3sc(C)cc32)C(c2ccc(C)cc2)(c2ccc(C)cc2)c2cc(C(C)(C)C)sc2-4)cc1 |
| InChI | InChI=1S/C49H44S2/c1-29-9-17-34(18-10-29)48(35-19-11-30(2)12-20-35)40-27-39-41(26-38(40)45-42(48)25-33(5)50-45)49(36-21-13-31(3)14-22-36,37-23-15-32(4)16-24-37)43-28-44(47(6,7)8)51-46(39)43/h9-28H,1-8H3 |
| InChIKey | FNGKTWSMNVCICN-UHFFFAOYSA-N |
| XLogP | 13.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.02 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |