C11H15N — CID 123756279
(3E)-3-ethynyl-6-methylocta-3,6-dien-2-imine (PubChem CID 123756279) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is (3E)-3-ethynyl-6-methylocta-3,6-dien-2-imine.
| Compound Name | (3E)-3-ethynyl-6-methylocta-3,6-dien-2-imine |
|---|---|
| PubChem CID | 123756279 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | (3E)-3-ethynyl-6-methylocta-3,6-dien-2-imine |
| SMILES | [H]/N=C(C)/C(C#C)=C/CC(C)=CC |
| InChI | InChI=1S/C11H15N/c1-5-9(3)7-8-11(6-2)10(4)12/h2,5,8,12H,7H2,1,3-4H3/b9-5?,11-8+,12-10+ |
| InChIKey | SALJDZFAKHCTRJ-ASZLAVCXSA-N |
| XLogP | 2.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|