C9H15N — CID 91523155
3,6-dimethylhepta-3,6-dien-2-imine (PubChem CID 91523155) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3,6-dimethylhepta-3,6-dien-2-imine.
| Compound Name | 3,6-dimethylhepta-3,6-dien-2-imine |
|---|---|
| PubChem CID | 91523155 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3,6-dimethylhepta-3,6-dien-2-imine |
| SMILES | [H]/N=C(\C)C(C)=CCC(=C)C |
| InChI | InChI=1S/C9H15N/c1-7(2)5-6-8(3)9(4)10/h6,10H,1,5H2,2-4H3/b8-6?,10-9+ |
| InChIKey | DPALKDKGHFICOC-NMGVWRBOSA-N |
| XLogP | 2.94 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|