C14H15NO — CID 123757263
9-methyl-2,3,9a,10a-tetrahydro-1H-acridin-4-one (PubChem CID 123757263) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is 9-methyl-2,3,9a,10a-tetrahydro-1H-acridin-4-one.
| Compound Name | 9-methyl-2,3,9a,10a-tetrahydro-1H-acridin-4-one |
|---|---|
| PubChem CID | 123757263 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 9-methyl-2,3,9a,10a-tetrahydro-1H-acridin-4-one |
| SMILES | CC1=C2C=CC=CC2N=C2C(=O)CCCC21 |
| InChI | InChI=1S/C14H15NO/c1-9-10-5-2-3-7-12(10)15-14-11(9)6-4-8-13(14)16/h2-3,5,7,11-12H,4,6,8H2,1H3 |
| InChIKey | MGQLVFOGHYPWDY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |