C27H35NO4S — CID 123758324
4-[8-[(4-methoxyphenyl)methylsulfonyl]-8-azaspiro[4.5]decan-3-yl]-1-phenylbutan-2-one (PubChem CID 123758324) has the molecular formula C27H35NO4S and a molecular weight of 469.65 g/mol. Its IUPAC name is 4-[8-[(4-methoxyphenyl)methylsulfonyl]-8-azaspiro[4.5]decan-3-yl]-1-phenylbutan-2-one.
| Compound Name | 4-[8-[(4-methoxyphenyl)methylsulfonyl]-8-azaspiro[4.5]decan-3-yl]-1-phenylbutan-2-one |
|---|---|
| PubChem CID | 123758324 |
| Molecular Formula | C27H35NO4S |
| Molecular Weight | 469.65 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 4-[8-[(4-methoxyphenyl)methylsulfonyl]-8-azaspiro[4.5]decan-3-yl]-1-phenylbutan-2-one |
| SMILES | COc1ccc(CS(=O)(=O)N2CCC3(CCC(CCC(=O)Cc4ccccc4)C3)CC2)cc1 |
| InChI | InChI=1S/C27H35NO4S/c1-32-26-11-8-24(9-12-26)21-33(30,31)28-17-15-27(16-18-28)14-13-23(20-27)7-10-25(29)19-22-5-3-2-4-6-22/h2-6,8-9,11-12,23H,7,10,13-21H2,1H3 |
| InChIKey | FBAQOFUCJHKZKH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |