C9H16N4O — CID 123760588
N-[2-(dimethylamino)ethyl]-2H-pyrazine-1-carboxamide (PubChem CID 123760588) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2H-pyrazine-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2H-pyrazine-1-carboxamide |
|---|---|
| PubChem CID | 123760588 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2H-pyrazine-1-carboxamide |
| SMILES | CN(C)CCNC(=O)N1C=CN=CC1 |
| InChI | InChI=1S/C9H16N4O/c1-12(2)6-5-11-9(14)13-7-3-10-4-8-13/h3-4,7H,5-6,8H2,1-2H3,(H,11,14) |
| InChIKey | PXQOJCZPAKAQFL-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |