C15H31N5O2 — CID 113105782
N-[2-(dimethylamino)ethyl]-4-(2-morpholin-4-ylethyl)piperazine-1-carboxamide (PubChem CID 113105782) has the molecular formula C15H31N5O2 and a molecular weight of 313.45 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-(2-morpholin-4-ylethyl)piperazine-1-carboxamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-(2-morpholin-4-ylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113105782 |
| Molecular Formula | C15H31N5O2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-(2-morpholin-4-ylethyl)piperazine-1-carboxamide |
| SMILES | CN(C)CCNC(=O)N1CCN(CCN2CCOCC2)CC1 |
| InChI | InChI=1S/C15H31N5O2/c1-17(2)4-3-16-15(21)20-9-7-18(8-10-20)5-6-19-11-13-22-14-12-19/h3-14H2,1-2H3,(H,16,21) |
| InChIKey | JQIDUMOLOUAZEI-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |