About 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole
5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole (PubChem CID 123761625) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole.
Analyze 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole?
The IUPAC name of 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole (CID 123761625) is 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole is CCC1CC1CC1=NCCC1.
What is the InChIKey of 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole?
The InChIKey is PJEPLCMJUBUBJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-2-8-6-9(8)7-10-4-3-5-11-10/h8-9H,2-7H2,1H3.
What are the key properties of 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole?
5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole has a molecular weight of 151.25 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-ethylcyclopropyl)methyl]-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 123761625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).