C16H26O4 — CID 123761722
4,5-dihydroxy-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one (PubChem CID 123761722) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 4,5-dihydroxy-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one.
| Compound Name | 4,5-dihydroxy-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
|---|---|
| PubChem CID | 123761722 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4,5-dihydroxy-3a,6,6,9a-tetramethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][1]benzofuran-2-one |
| SMILES | CC1(C)CCCC2(C)C1C(O)C(O)C1(C)OC(=O)CC21 |
| InChI | InChI=1S/C16H26O4/c1-14(2)6-5-7-15(3)9-8-10(17)20-16(9,4)13(19)11(18)12(14)15/h9,11-13,18-19H,5-8H2,1-4H3 |
| InChIKey | SRKDUNRNENAEJS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |