C23H29N2O6+ — CID 123761853
1-O'-tert-butyl 2-O'-methyl 6-hydroxy-5-methylspiro[1,2-dihydropyrano[2,3-c]quinolin-6-ium-3,4'-pyrrolidine]-1',2'-dicarboxylate (PubChem CID 123761853) has the molecular formula C23H29N2O6+ and a molecular weight of 429.49 g/mol. Its IUPAC name is 1-O'-tert-butyl 2-O'-methyl 6-hydroxy-5-methylspiro[1,2-dihydropyrano[2,3-c]quinolin-6-ium-3,4'-pyrrolidine]-1',2'-dicarboxylate.
| Compound Name | 1-O'-tert-butyl 2-O'-methyl 6-hydroxy-5-methylspiro[1,2-dihydropyrano[2,3-c]quinolin-6-ium-3,4'-pyrrolidine]-1',2'-dicarboxylate |
|---|---|
| PubChem CID | 123761853 |
| Molecular Formula | C23H29N2O6+ |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 1-O'-tert-butyl 2-O'-methyl 6-hydroxy-5-methylspiro[1,2-dihydropyrano[2,3-c]quinolin-6-ium-3,4'-pyrrolidine]-1',2'-dicarboxylate |
| SMILES | COC(=O)C1CC2(CCc3c(c(C)[n+](O)c4ccccc34)O2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H29N2O6/c1-14-19-16(15-8-6-7-9-17(15)25(14)28)10-11-23(30-19)12-18(20(26)29-5)24(13-23)21(27)31-22(2,3)4/h6-9,18,28H,10-13H2,1-5H3/q+1 |
| InChIKey | RCRWYOFGVJEOIW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|