C7H7NS — CID 123761861
3-ethyl-5-ethynyl-1,2-thiazole (PubChem CID 123761861) has the molecular formula C7H7NS and a molecular weight of 137.21 g/mol. Its IUPAC name is 3-ethyl-5-ethynyl-1,2-thiazole.
| Compound Name | 3-ethyl-5-ethynyl-1,2-thiazole |
|---|---|
| PubChem CID | 123761861 |
| Molecular Formula | C7H7NS |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.03 |
| IUPAC Name | 3-ethyl-5-ethynyl-1,2-thiazole |
| SMILES | C#Cc1cc(CC)ns1 |
| InChI | InChI=1S/C7H7NS/c1-3-6-5-7(4-2)9-8-6/h2,5H,3H2,1H3 |
| InChIKey | AOAXDAMAWDKVLG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|