C11H26O4Si3 — CID 123762143
3-[bis(trimethylsilyloxy)methylsilyl]-2-methylprop-2-enoic acid (PubChem CID 123762143) has the molecular formula C11H26O4Si3 and a molecular weight of 306.58 g/mol. Its IUPAC name is 3-[bis(trimethylsilyloxy)methylsilyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[bis(trimethylsilyloxy)methylsilyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 123762143 |
| Molecular Formula | C11H26O4Si3 |
| Molecular Weight | 306.58 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-[bis(trimethylsilyloxy)methylsilyl]-2-methylprop-2-enoic acid |
| SMILES | CC(=C[SiH2]C(O[Si](C)(C)C)O[Si](C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H26O4Si3/c1-9(10(12)13)8-16-11(14-17(2,3)4)15-18(5,6)7/h8,11H,16H2,1-7H3,(H,12,13) |
| InChIKey | RNKVATQVWZWMNO-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|