C14H20 — CID 123762881
1,2,4-trimethyl-5-(3-methylcyclobutyl)benzene (PubChem CID 123762881) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,2,4-trimethyl-5-(3-methylcyclobutyl)benzene.
| Compound Name | 1,2,4-trimethyl-5-(3-methylcyclobutyl)benzene |
|---|---|
| PubChem CID | 123762881 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1,2,4-trimethyl-5-(3-methylcyclobutyl)benzene |
| SMILES | Cc1cc(C)c(C2CC(C)C2)cc1C |
| InChI | InChI=1S/C14H20/c1-9-5-13(6-9)14-8-11(3)10(2)7-12(14)4/h7-9,13H,5-6H2,1-4H3 |
| InChIKey | SMEJSBZZAJWSLV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |