C8H12N+ — CID 123763898
cyclohexa-1,5-dien-1-yl-methyl-methylideneazanium (PubChem CID 123763898) has the molecular formula C8H12N+ and a molecular weight of 122.19 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-methyl-methylideneazanium.
| Compound Name | cyclohexa-1,5-dien-1-yl-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123763898 |
| Molecular Formula | C8H12N+ |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.10 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-methyl-methylideneazanium |
| SMILES | C=[N+](C)C1=CCCC=C1 |
| InChI | InChI=1S/C8H12N/c1-9(2)8-6-4-3-5-7-8/h4,6-7H,1,3,5H2,2H3/q+1 |
| InChIKey | ZNFVGEPBOIGUIE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|