C23H19F2N3O — CID 123764054
1-[4-(2-cyclopropylethynyl)-3,5-difluorophenyl]-2-imidazol-1-yl-N-phenylmethoxyethanimine (PubChem CID 123764054) has the molecular formula C23H19F2N3O and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-[4-(2-cyclopropylethynyl)-3,5-difluorophenyl]-2-imidazol-1-yl-N-phenylmethoxyethanimine.
| Compound Name | 1-[4-(2-cyclopropylethynyl)-3,5-difluorophenyl]-2-imidazol-1-yl-N-phenylmethoxyethanimine |
|---|---|
| PubChem CID | 123764054 |
| Molecular Formula | C23H19F2N3O |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-[4-(2-cyclopropylethynyl)-3,5-difluorophenyl]-2-imidazol-1-yl-N-phenylmethoxyethanimine |
| SMILES | Fc1cc(C(Cn2ccnc2)=NOCc2ccccc2)cc(F)c1C#CC1CC1 |
| InChI | InChI=1S/C23H19F2N3O/c24-21-12-19(13-22(25)20(21)9-8-17-6-7-17)23(14-28-11-10-26-16-28)27-29-15-18-4-2-1-3-5-18/h1-5,10-13,16-17H,6-7,14-15H2 |
| InChIKey | DVKCYARSYFJNTL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|