C8H18F3NOSi — CID 123764176
3-silyl-1-(5,5,5-trifluoropentan-2-yloxy)propan-1-amine (PubChem CID 123764176) has the molecular formula C8H18F3NOSi and a molecular weight of 229.32 g/mol. Its IUPAC name is 3-silyl-1-(5,5,5-trifluoropentan-2-yloxy)propan-1-amine.
| Compound Name | 3-silyl-1-(5,5,5-trifluoropentan-2-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 123764176 |
| Molecular Formula | C8H18F3NOSi |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-silyl-1-(5,5,5-trifluoropentan-2-yloxy)propan-1-amine |
| SMILES | CC(CCC(F)(F)F)OC(N)CC[SiH3] |
| InChI | InChI=1S/C8H18F3NOSi/c1-6(2-4-8(9,10)11)13-7(12)3-5-14/h6-7H,2-5,12H2,1,14H3 |
| InChIKey | LRHVCNLCLMMPDY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|